C14H16ClNO7 — CID 174814465
(2S,3S,4R,5S,6S)-6-chloro-4-(3-hydroxyindol-3-yl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 174814465) has the molecular formula C14H16ClNO7 and a molecular weight of 345.74 g/mol. Its IUPAC name is (2S,3S,4R,5S,6S)-6-chloro-4-(3-hydroxyindol-3-yl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4R,5S,6S)-6-chloro-4-(3-hydroxyindol-3-yl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 174814465 |
| Molecular Formula | C14H16ClNO7 |
| Molecular Weight | 345.74 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | (2S,3S,4R,5S,6S)-6-chloro-4-(3-hydroxyindol-3-yl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC[C@@]1(Cl)O[C@H](O)[C@@H](O)[C@](O)(C2(O)C=Nc3ccccc32)[C@@H]1O |
| InChI | InChI=1S/C14H16ClNO7/c15-13(6-17)11(20)14(22,9(18)10(19)23-13)12(21)5-16-8-4-2-1-3-7(8)12/h1-5,9-11,17-22H,6H2/t9-,10+,11-,12?,13-,14-/m1/s1 |
| InChIKey | UOVYHHCRRUMZHW-TYLBVNNYSA-N |
| XLogP | -1.68 |
| TPSA | 142.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.74 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|