C14H14ClNO8 — CID 174814474
(2S,3S,4S,5S,6R)-4-chloro-3,4,5,6-tetrahydroxy-3-(3-hydroxyindol-3-yl)oxane-2-carboxylic acid (PubChem CID 174814474) has the molecular formula C14H14ClNO8 and a molecular weight of 359.72 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-4-chloro-3,4,5,6-tetrahydroxy-3-(3-hydroxyindol-3-yl)oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5S,6R)-4-chloro-3,4,5,6-tetrahydroxy-3-(3-hydroxyindol-3-yl)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 174814474 |
| Molecular Formula | C14H14ClNO8 |
| Molecular Weight | 359.72 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | (2S,3S,4S,5S,6R)-4-chloro-3,4,5,6-tetrahydroxy-3-(3-hydroxyindol-3-yl)oxane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1O[C@@H](O)[C@H](O)[C@](O)(Cl)[C@@]1(O)C1(O)C=Nc2ccccc21 |
| InChI | InChI=1S/C14H14ClNO8/c15-14(23)8(17)11(20)24-9(10(18)19)13(14,22)12(21)5-16-7-4-2-1-3-6(7)12/h1-5,8-9,11,17,20-23H,(H,18,19)/t8-,9+,11+,12?,13-,14+/m0/s1 |
| InChIKey | PXJQOPXHXWAFKT-PQQDVTEJSA-N |
| XLogP | -1.59 |
| TPSA | 160.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.72 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|