C13H13BrClNO6 — CID 175240839
(2S,3S,4R,5S)-6-bromo-5-chloro-4-(3-hydroxyindol-3-yl)oxane-2,3,4,5-tetrol (PubChem CID 175240839) has the molecular formula C13H13BrClNO6 and a molecular weight of 394.61 g/mol. Its IUPAC name is (2S,3S,4R,5S)-6-bromo-5-chloro-4-(3-hydroxyindol-3-yl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4R,5S)-6-bromo-5-chloro-4-(3-hydroxyindol-3-yl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 175240839 |
| Molecular Formula | C13H13BrClNO6 |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 392.96 |
| IUPAC Name | (2S,3S,4R,5S)-6-bromo-5-chloro-4-(3-hydroxyindol-3-yl)oxane-2,3,4,5-tetrol |
| SMILES | O[C@@H]1[C@@H](O)OC(Br)[C@@](O)(Cl)[C@]1(O)C1(O)C=Nc2ccccc21 |
| InChI | InChI=1S/C13H13BrClNO6/c14-10-13(15,21)12(20,8(17)9(18)22-10)11(19)5-16-7-4-2-1-3-6(7)11/h1-5,8-10,17-21H/t8-,9+,10?,11?,12-,13+/m1/s1 |
| InChIKey | KLGXKUORWXKFLB-PMMROLBOSA-N |
| XLogP | -0.32 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|