About 1-cyclopropyl-2-methyl-2H-pyridine;pentan-3-one
1-cyclopropyl-2-methyl-2H-pyridine;pentan-3-one (PubChem CID 174707018) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-cyclopropyl-2-methyl-2H-pyridine;pentan-3-one.
Molecular Properties
| Compound Name | 1-cyclopropyl-2-methyl-2H-pyridine;pentan-3-one |
| PubChem CID | 174707018 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-cyclopropyl-2-methyl-2H-pyridine;pentan-3-one |
| SMILES | CC1C=CC=CN1C1CC1.CCC(=O)CC |
| InChI | InChI=1S/C9H13N.C5H10O/c1-8-4-2-3-7-10(8)9-5-6-9;1-3-5(6)4-2/h2-4,7-9H,5-6H2,1H3;3-4H2,1-2H3 |
| InChIKey | BPSKPHJEZCMYAQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopropyl-2-methyl-2H-pyridine;pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2-methyl-2H-pyridine;pentan-3-one?
The IUPAC name of 1-cyclopropyl-2-methyl-2H-pyridine;pentan-3-one (CID 174707018) is 1-cyclopropyl-2-methyl-2H-pyridine;pentan-3-one.
What is the SMILES notation for 1-cyclopropyl-2-methyl-2H-pyridine;pentan-3-one?
The canonical SMILES for 1-cyclopropyl-2-methyl-2H-pyridine;pentan-3-one is CC1C=CC=CN1C1CC1.CCC(=O)CC.
What is the InChIKey of 1-cyclopropyl-2-methyl-2H-pyridine;pentan-3-one?
The InChIKey is BPSKPHJEZCMYAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.C5H10O/c1-8-4-2-3-7-10(8)9-5-6-9;1-3-5(6)4-2/h2-4,7-9H,5-6H2,1H3;3-4H2,1-2H3.
What are the key properties of 1-cyclopropyl-2-methyl-2H-pyridine;pentan-3-one?
1-cyclopropyl-2-methyl-2H-pyridine;pentan-3-one has a molecular weight of 221.34 g/mol, XLogP of 3.30, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2-methyl-2H-pyridine;pentan-3-one is sourced from PubChem (CID 174707018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).