C15H20N4 — CID 174707588
3,5-dimethyl-2-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidine (PubChem CID 174707588) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 3,5-dimethyl-2-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidine.
| Compound Name | 3,5-dimethyl-2-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidine |
|---|---|
| PubChem CID | 174707588 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 3,5-dimethyl-2-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidine |
| SMILES | CC1CNC(c2nc(-c3ccccc3)n[nH]2)C(C)C1 |
| InChI | InChI=1S/C15H20N4/c1-10-8-11(2)13(16-9-10)15-17-14(18-19-15)12-6-4-3-5-7-12/h3-7,10-11,13,16H,8-9H2,1-2H3,(H,17,18,19) |
| InChIKey | CHBVUVNHEBKYLV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |