C22H20FN3O4S — CID 174707738
1,3-dimethoxybenzene;3-(4-fluorophenyl)sulfonylquinoxalin-2-amine (PubChem CID 174707738) has the molecular formula C22H20FN3O4S and a molecular weight of 441.48 g/mol. Its IUPAC name is 1,3-dimethoxybenzene;3-(4-fluorophenyl)sulfonylquinoxalin-2-amine.
| Compound Name | 1,3-dimethoxybenzene;3-(4-fluorophenyl)sulfonylquinoxalin-2-amine |
|---|---|
| PubChem CID | 174707738 |
| Molecular Formula | C22H20FN3O4S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 1,3-dimethoxybenzene;3-(4-fluorophenyl)sulfonylquinoxalin-2-amine |
| SMILES | COc1cccc(OC)c1.Nc1nc2ccccc2nc1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H10FN3O2S.C8H10O2/c15-9-5-7-10(8-6-9)21(19,20)14-13(16)17-11-3-1-2-4-12(11)18-14;1-9-7-4-3-5-8(6-7)10-2/h1-8H,(H2,16,17);3-6H,1-2H3 |
| InChIKey | LKPNURZPNZLIRP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |