C22H18FN3O4S — CID 141267265
5-(3,5-dimethoxyphenyl)-3-(4-fluorophenyl)sulfonylquinoxalin-2-amine (PubChem CID 141267265) has the molecular formula C22H18FN3O4S and a molecular weight of 439.47 g/mol. Its IUPAC name is 5-(3,5-dimethoxyphenyl)-3-(4-fluorophenyl)sulfonylquinoxalin-2-amine.
| Compound Name | 5-(3,5-dimethoxyphenyl)-3-(4-fluorophenyl)sulfonylquinoxalin-2-amine |
|---|---|
| PubChem CID | 141267265 |
| Molecular Formula | C22H18FN3O4S |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 5-(3,5-dimethoxyphenyl)-3-(4-fluorophenyl)sulfonylquinoxalin-2-amine |
| SMILES | COc1cc(OC)cc(-c2cccc3nc(N)c(S(=O)(=O)c4ccc(F)cc4)nc23)c1 |
| InChI | InChI=1S/C22H18FN3O4S/c1-29-15-10-13(11-16(12-15)30-2)18-4-3-5-19-20(18)26-22(21(24)25-19)31(27,28)17-8-6-14(23)7-9-17/h3-12H,1-2H3,(H2,24,25) |
| InChIKey | BKNWRAWKKCOSNW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |