C31H46O3 — CID 174708470
2,4-bis[3-tert-butyl-5-(2-hydroxypropan-2-yl)phenyl]pentan-3-one (PubChem CID 174708470) has the molecular formula C31H46O3 and a molecular weight of 466.71 g/mol. Its IUPAC name is 2,4-bis[3-tert-butyl-5-(2-hydroxypropan-2-yl)phenyl]pentan-3-one.
| Compound Name | 2,4-bis[3-tert-butyl-5-(2-hydroxypropan-2-yl)phenyl]pentan-3-one |
|---|---|
| PubChem CID | 174708470 |
| Molecular Formula | C31H46O3 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | 2,4-bis[3-tert-butyl-5-(2-hydroxypropan-2-yl)phenyl]pentan-3-one |
| SMILES | CC(C(=O)C(C)c1cc(C(C)(C)C)cc(C(C)(C)O)c1)c1cc(C(C)(C)C)cc(C(C)(C)O)c1 |
| InChI | InChI=1S/C31H46O3/c1-19(21-13-23(28(3,4)5)17-25(15-21)30(9,10)33)27(32)20(2)22-14-24(29(6,7)8)18-26(16-22)31(11,12)34/h13-20,33-34H,1-12H3 |
| InChIKey | RDHTVQBADDCOQZ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |