C14H20O3 — CID 59095336
1-[3,5-bis(2-hydroxypropan-2-yl)phenyl]ethanone (PubChem CID 59095336) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-[3,5-bis(2-hydroxypropan-2-yl)phenyl]ethanone.
| Compound Name | 1-[3,5-bis(2-hydroxypropan-2-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 59095336 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1-[3,5-bis(2-hydroxypropan-2-yl)phenyl]ethanone |
| SMILES | CC(=O)c1cc(C(C)(C)O)cc(C(C)(C)O)c1 |
| InChI | InChI=1S/C14H20O3/c1-9(15)10-6-11(13(2,3)16)8-12(7-10)14(4,5)17/h6-8,16-17H,1-5H3 |
| InChIKey | HWUCZGUFRINFBI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |