C17H28O3 — CID 59095277
2-[3-(2-hydroxybutan-2-yl)-5-(2-hydroxypropan-2-yl)phenyl]butan-2-ol (PubChem CID 59095277) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-[3-(2-hydroxybutan-2-yl)-5-(2-hydroxypropan-2-yl)phenyl]butan-2-ol.
| Compound Name | 2-[3-(2-hydroxybutan-2-yl)-5-(2-hydroxypropan-2-yl)phenyl]butan-2-ol |
|---|---|
| PubChem CID | 59095277 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2-[3-(2-hydroxybutan-2-yl)-5-(2-hydroxypropan-2-yl)phenyl]butan-2-ol |
| SMILES | CCC(C)(O)c1cc(C(C)(C)O)cc(C(C)(O)CC)c1 |
| InChI | InChI=1S/C17H28O3/c1-7-16(5,19)13-9-12(15(3,4)18)10-14(11-13)17(6,20)8-2/h9-11,18-20H,7-8H2,1-6H3 |
| InChIKey | GWKWBMVCBLZJIS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |