C18H29IO3 — CID 59095282
2-[3,5-bis(2-hydroxybutan-2-yl)-4-iodophenyl]butan-2-ol (PubChem CID 59095282) has the molecular formula C18H29IO3 and a molecular weight of 420.33 g/mol. Its IUPAC name is 2-[3,5-bis(2-hydroxybutan-2-yl)-4-iodophenyl]butan-2-ol.
| Compound Name | 2-[3,5-bis(2-hydroxybutan-2-yl)-4-iodophenyl]butan-2-ol |
|---|---|
| PubChem CID | 59095282 |
| Molecular Formula | C18H29IO3 |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 2-[3,5-bis(2-hydroxybutan-2-yl)-4-iodophenyl]butan-2-ol |
| SMILES | CCC(C)(O)c1cc(C(C)(O)CC)c(I)c(C(C)(O)CC)c1 |
| InChI | InChI=1S/C18H29IO3/c1-7-16(4,20)12-10-13(17(5,21)8-2)15(19)14(11-12)18(6,22)9-3/h10-11,20-22H,7-9H2,1-6H3 |
| InChIKey | NQXNNPQXZDJHCG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|