C16H26O3 — CID 59095341
2-[3,5-bis(2-hydroxypropan-2-yl)phenyl]butan-2-ol (PubChem CID 59095341) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-[3,5-bis(2-hydroxypropan-2-yl)phenyl]butan-2-ol.
| Compound Name | 2-[3,5-bis(2-hydroxypropan-2-yl)phenyl]butan-2-ol |
|---|---|
| PubChem CID | 59095341 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2-[3,5-bis(2-hydroxypropan-2-yl)phenyl]butan-2-ol |
| SMILES | CCC(C)(O)c1cc(C(C)(C)O)cc(C(C)(C)O)c1 |
| InChI | InChI=1S/C16H26O3/c1-7-16(6,19)13-9-11(14(2,3)17)8-12(10-13)15(4,5)18/h8-10,17-19H,7H2,1-6H3 |
| InChIKey | DXJKCQHKFPIQTQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |