C14H17BrF3NO2 — CID 174712238
[4-(1-bromoethyl)-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate (PubChem CID 174712238) has the molecular formula C14H17BrF3NO2 and a molecular weight of 368.19 g/mol. Its IUPAC name is [4-(1-bromoethyl)-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate.
| Compound Name | [4-(1-bromoethyl)-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174712238 |
| Molecular Formula | C14H17BrF3NO2 |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | [4-(1-bromoethyl)-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate |
| SMILES | CC(Br)c1ccc(NOC(=O)C(C)(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C14H17BrF3NO2/c1-8(15)10-6-5-9(7-11(10)14(16,17)18)19-21-12(20)13(2,3)4/h5-8,19H,1-4H3 |
| InChIKey | MOPKSYYJRMWERQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|