C26H56O2S2Sn — CID 174712693
2,2-bis(sulfanyl)acetic acid;6-methylheptyl(dioctyl)stannane (PubChem CID 174712693) has the molecular formula C26H56O2S2Sn and a molecular weight of 583.58 g/mol. Its IUPAC name is 2,2-bis(sulfanyl)acetic acid;6-methylheptyl(dioctyl)stannane.
| Compound Name | 2,2-bis(sulfanyl)acetic acid;6-methylheptyl(dioctyl)stannane |
|---|---|
| PubChem CID | 174712693 |
| Molecular Formula | C26H56O2S2Sn |
| Molecular Weight | 583.58 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | 2,2-bis(sulfanyl)acetic acid;6-methylheptyl(dioctyl)stannane |
| SMILES | CCCCCCCC[SnH](CCCCCCCC)CCCCCC(C)C.O=C(O)C(S)S |
| InChI | InChI=1S/3C8H17.C2H4O2S2.Sn.H/c1-4-5-6-7-8(2)3;2*1-3-5-7-8-6-4-2;3-1(4)2(5)6;;/h8H,1,4-7H2,2-3H3;2*1,3-8H2,2H3;2,5-6H,(H,3,4);; |
| InChIKey | DLSGJBKHDLPXDR-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.58 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|