About 2-dioctylstannyl-2-sulfanylacetic acid;2-methylheptane
2-dioctylstannyl-2-sulfanylacetic acid;2-methylheptane (PubChem CID 174796111) has the molecular formula C26H56O2SSn
and a molecular weight of 551.51 g/mol. Its IUPAC name is 2-dioctylstannyl-2-sulfanylacetic acid;2-methylheptane.
Molecular Properties
| Compound Name | 2-dioctylstannyl-2-sulfanylacetic acid;2-methylheptane |
| PubChem CID | 174796111 |
| Molecular Formula | C26H56O2SSn |
| Molecular Weight | 551.51 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | 2-dioctylstannyl-2-sulfanylacetic acid;2-methylheptane |
| SMILES | CCCCCC(C)C.CCCCCCCC[SnH](CCCCCCCC)C(S)C(=O)O |
| InChI | InChI=1S/C8H18.2C8H17.C2H3O2S.Sn.H/c1-4-5-6-7-8(2)3;2*1-3-5-7-8-6-4-2;3-2(4)1-5;;/h8H,4-7H2,1-3H3;2*1,3-8H2,2H3;1,5H,(H,3,4);; |
| InChIKey | XJXDQEFLZGLWTP-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 551.51 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-dioctylstannyl-2-sulfanylacetic acid;2-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dioctylstannyl-2-sulfanylacetic acid;2-methylheptane?
The IUPAC name of 2-dioctylstannyl-2-sulfanylacetic acid;2-methylheptane (CID 174796111) is 2-dioctylstannyl-2-sulfanylacetic acid;2-methylheptane.
What is the SMILES notation for 2-dioctylstannyl-2-sulfanylacetic acid;2-methylheptane?
The canonical SMILES for 2-dioctylstannyl-2-sulfanylacetic acid;2-methylheptane is CCCCCC(C)C.CCCCCCCC[SnH](CCCCCCCC)C(S)C(=O)O.
What is the InChIKey of 2-dioctylstannyl-2-sulfanylacetic acid;2-methylheptane?
The InChIKey is XJXDQEFLZGLWTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.2C8H17.C2H3O2S.Sn.H/c1-4-5-6-7-8(2)3;2*1-3-5-7-8-6-4-2;3-2(4)1-5;;/h8H,4-7H2,1-3H3;2*1,3-8H2,2H3;1,5H,(H,3,4);;.
What are the key properties of 2-dioctylstannyl-2-sulfanylacetic acid;2-methylheptane?
2-dioctylstannyl-2-sulfanylacetic acid;2-methylheptane has a molecular weight of 551.51 g/mol, XLogP of 9.08, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dioctylstannyl-2-sulfanylacetic acid;2-methylheptane is sourced from PubChem (CID 174796111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).