C13H19NO2 — CID 174714521
(3,5-dimethylanilino) 2-methylbutanoate (PubChem CID 174714521) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (3,5-dimethylanilino) 2-methylbutanoate.
| Compound Name | (3,5-dimethylanilino) 2-methylbutanoate |
|---|---|
| PubChem CID | 174714521 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (3,5-dimethylanilino) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)ONc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C13H19NO2/c1-5-11(4)13(15)16-14-12-7-9(2)6-10(3)8-12/h6-8,11,14H,5H2,1-4H3 |
| InChIKey | NYXNJVPVKHXLFH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|