C17H26O — CID 176674966
1-[(Z)-3-methoxy-5-methylhept-3-en-4-yl]-3,5-dimethylbenzene (PubChem CID 176674966) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 1-[(Z)-3-methoxy-5-methylhept-3-en-4-yl]-3,5-dimethylbenzene.
| Compound Name | 1-[(Z)-3-methoxy-5-methylhept-3-en-4-yl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 176674966 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 1-[(Z)-3-methoxy-5-methylhept-3-en-4-yl]-3,5-dimethylbenzene |
| SMILES | CC/C(OC)=C(/c1cc(C)cc(C)c1)C(C)CC |
| InChI | InChI=1S/C17H26O/c1-7-14(5)17(16(8-2)18-6)15-10-12(3)9-13(4)11-15/h9-11,14H,7-8H2,1-6H3/b17-16- |
| InChIKey | YVGPIDFFFCMWPV-MSUUIHNZSA-N |
| XLogP | 5.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|