C20H26N2O3 — CID 174718439
[4-[4-(2-aminoethoxy)phenyl]-5-phenylpentyl] carbamate (PubChem CID 174718439) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is [4-[4-(2-aminoethoxy)phenyl]-5-phenylpentyl] carbamate.
| Compound Name | [4-[4-(2-aminoethoxy)phenyl]-5-phenylpentyl] carbamate |
|---|---|
| PubChem CID | 174718439 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | [4-[4-(2-aminoethoxy)phenyl]-5-phenylpentyl] carbamate |
| SMILES | NCCOc1ccc(C(CCCOC(N)=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H26N2O3/c21-12-14-24-19-10-8-17(9-11-19)18(7-4-13-25-20(22)23)15-16-5-2-1-3-6-16/h1-3,5-6,8-11,18H,4,7,12-15,21H2,(H2,22,23) |
| InChIKey | WLSLYFUWIGNVMH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|