C11H16O2 — CID 174719247
2-(1-methoxycyclopenta-2,4-dien-1-yl)pentanal (PubChem CID 174719247) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-(1-methoxycyclopenta-2,4-dien-1-yl)pentanal.
| Compound Name | 2-(1-methoxycyclopenta-2,4-dien-1-yl)pentanal |
|---|---|
| PubChem CID | 174719247 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-(1-methoxycyclopenta-2,4-dien-1-yl)pentanal |
| SMILES | CCCC(C=O)C1(OC)C=CC=C1 |
| InChI | InChI=1S/C11H16O2/c1-3-6-10(9-12)11(13-2)7-4-5-8-11/h4-5,7-10H,3,6H2,1-2H3 |
| InChIKey | GRLPZCDBAFKEJE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|