C9H11ClN2O5S — CID 174719438
2-[(2-chloro-3-pyridinyl)-sulfoamino]-2-methylpropanoic acid (PubChem CID 174719438) has the molecular formula C9H11ClN2O5S and a molecular weight of 294.72 g/mol. Its IUPAC name is 2-[(2-chloro-3-pyridinyl)-sulfoamino]-2-methylpropanoic acid.
| Compound Name | 2-[(2-chloro-3-pyridinyl)-sulfoamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 174719438 |
| Molecular Formula | C9H11ClN2O5S |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 2-[(2-chloro-3-pyridinyl)-sulfoamino]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)N(c1cccnc1Cl)S(=O)(=O)O |
| InChI | InChI=1S/C9H11ClN2O5S/c1-9(2,8(13)14)12(18(15,16)17)6-4-3-5-11-7(6)10/h3-5H,1-2H3,(H,13,14)(H,15,16,17) |
| InChIKey | RKITZCCPXKNFTR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|