C10H11F2NO5S — CID 174719384
2-(2,4-difluoro-N-sulfoanilino)-2-methylpropanoic acid (PubChem CID 174719384) has the molecular formula C10H11F2NO5S and a molecular weight of 295.26 g/mol. Its IUPAC name is 2-(2,4-difluoro-N-sulfoanilino)-2-methylpropanoic acid.
| Compound Name | 2-(2,4-difluoro-N-sulfoanilino)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 174719384 |
| Molecular Formula | C10H11F2NO5S |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 2-(2,4-difluoro-N-sulfoanilino)-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)N(c1ccc(F)cc1F)S(=O)(=O)O |
| InChI | InChI=1S/C10H11F2NO5S/c1-10(2,9(14)15)13(19(16,17)18)8-4-3-6(11)5-7(8)12/h3-5H,1-2H3,(H,14,15)(H,16,17,18) |
| InChIKey | SDBDWQOBNVUGAW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|