C17H19F2NO2S — CID 3857944
N-(2,4-difluorophenyl)-N,2,3,5,6-pentamethylbenzenesulfonamide (PubChem CID 3857944) has the molecular formula C17H19F2NO2S and a molecular weight of 339.41 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-N,2,3,5,6-pentamethylbenzenesulfonamide.
| Compound Name | N-(2,4-difluorophenyl)-N,2,3,5,6-pentamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3857944 |
| Molecular Formula | C17H19F2NO2S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N-(2,4-difluorophenyl)-N,2,3,5,6-pentamethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N(C)c2ccc(F)cc2F)c1C |
| InChI | InChI=1S/C17H19F2NO2S/c1-10-8-11(2)13(4)17(12(10)3)23(21,22)20(5)16-7-6-14(18)9-15(16)19/h6-9H,1-5H3 |
| InChIKey | UEVMQHOENNKQLY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |