C7H6F2O6S2 — CID 174720518
(2,3-difluorophenoxy)sulfonylmethanesulfonic acid (PubChem CID 174720518) has the molecular formula C7H6F2O6S2 and a molecular weight of 288.25 g/mol. Its IUPAC name is (2,3-difluorophenoxy)sulfonylmethanesulfonic acid.
| Compound Name | (2,3-difluorophenoxy)sulfonylmethanesulfonic acid |
|---|---|
| PubChem CID | 174720518 |
| Molecular Formula | C7H6F2O6S2 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | (2,3-difluorophenoxy)sulfonylmethanesulfonic acid |
| SMILES | O=S(=O)(O)CS(=O)(=O)Oc1cccc(F)c1F |
| InChI | InChI=1S/C7H6F2O6S2/c8-5-2-1-3-6(7(5)9)15-17(13,14)4-16(10,11)12/h1-3H,4H2,(H,10,11,12) |
| InChIKey | DWWMZQROQQTSJC-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|