About 2-hydroxy-N-phenyl-3-(trifluoromethyl)benzamide;octanal
2-hydroxy-N-phenyl-3-(trifluoromethyl)benzamide;octanal (PubChem CID 174730794) has the molecular formula C22H26F3NO3
and a molecular weight of 409.45 g/mol. Its IUPAC name is 2-hydroxy-N-phenyl-3-(trifluoromethyl)benzamide;octanal.
Molecular Properties
| Compound Name | 2-hydroxy-N-phenyl-3-(trifluoromethyl)benzamide;octanal |
| PubChem CID | 174730794 |
| Molecular Formula | C22H26F3NO3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 2-hydroxy-N-phenyl-3-(trifluoromethyl)benzamide;octanal |
| SMILES | CCCCCCCC=O.O=C(Nc1ccccc1)c1cccc(C(F)(F)F)c1O |
| InChI | InChI=1S/C14H10F3NO2.C8H16O/c15-14(16,17)11-8-4-7-10(12(11)19)13(20)18-9-5-2-1-3-6-9;1-2-3-4-5-6-7-8-9/h1-8,19H,(H,18,20);8H,2-7H2,1H3 |
| InChIKey | OOAZSYUEAUQACJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-N-phenyl-3-(trifluoromethyl)benzamide;octanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N-phenyl-3-(trifluoromethyl)benzamide;octanal?
The IUPAC name of 2-hydroxy-N-phenyl-3-(trifluoromethyl)benzamide;octanal (CID 174730794) is 2-hydroxy-N-phenyl-3-(trifluoromethyl)benzamide;octanal.
What is the SMILES notation for 2-hydroxy-N-phenyl-3-(trifluoromethyl)benzamide;octanal?
The canonical SMILES for 2-hydroxy-N-phenyl-3-(trifluoromethyl)benzamide;octanal is CCCCCCCC=O.O=C(Nc1ccccc1)c1cccc(C(F)(F)F)c1O.
What is the InChIKey of 2-hydroxy-N-phenyl-3-(trifluoromethyl)benzamide;octanal?
The InChIKey is OOAZSYUEAUQACJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3NO2.C8H16O/c15-14(16,17)11-8-4-7-10(12(11)19)13(20)18-9-5-2-1-3-6-9;1-2-3-4-5-6-7-8-9/h1-8,19H,(H,18,20);8H,2-7H2,1H3.
What are the key properties of 2-hydroxy-N-phenyl-3-(trifluoromethyl)benzamide;octanal?
2-hydroxy-N-phenyl-3-(trifluoromethyl)benzamide;octanal has a molecular weight of 409.45 g/mol, XLogP of 6.21, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N-phenyl-3-(trifluoromethyl)benzamide;octanal is sourced from PubChem (CID 174730794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).