C13H32N2OSi — CID 174730947
N'-(2-butyl-2-methoxysilylhexyl)ethane-1,2-diamine (PubChem CID 174730947) has the molecular formula C13H32N2OSi and a molecular weight of 260.50 g/mol. Its IUPAC name is N'-(2-butyl-2-methoxysilylhexyl)ethane-1,2-diamine.
| Compound Name | N'-(2-butyl-2-methoxysilylhexyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 174730947 |
| Molecular Formula | C13H32N2OSi |
| Molecular Weight | 260.50 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N'-(2-butyl-2-methoxysilylhexyl)ethane-1,2-diamine |
| SMILES | CCCCC(CCCC)(CNCCN)[SiH2]OC |
| InChI | InChI=1S/C13H32N2OSi/c1-4-6-8-13(17-16-3,9-7-5-2)12-15-11-10-14/h15H,4-12,14,17H2,1-3H3 |
| InChIKey | CZUIFJYXXSTPNG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.50 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|