C28H28FN5 — CID 174731535
2-[(3-fluorophenyl)methyl]-2-azatricyclo[4.3.0.03,8]nona-1(9),3(8),4,6-tetraene;4-N-pentylquinazoline-4,6-diamine (PubChem CID 174731535) has the molecular formula C28H28FN5 and a molecular weight of 453.57 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-2-azatricyclo[4.3.0.03,8]nona-1(9),3(8),4,6-tetraene;4-N-pentylquinazoline-4,6-diamine.
| Compound Name | 2-[(3-fluorophenyl)methyl]-2-azatricyclo[4.3.0.03,8]nona-1(9),3(8),4,6-tetraene;4-N-pentylquinazoline-4,6-diamine |
|---|---|
| PubChem CID | 174731535 |
| Molecular Formula | C28H28FN5 |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-2-azatricyclo[4.3.0.03,8]nona-1(9),3(8),4,6-tetraene;4-N-pentylquinazoline-4,6-diamine |
| SMILES | CCCCCNc1ncnc2ccc(N)cc12.Fc1cccc(Cn2c3cc4cc-3ccc42)c1 |
| InChI | InChI=1S/C15H10FN.C13H18N4/c16-13-3-1-2-10(6-13)9-17-14-5-4-11-7-12(14)8-15(11)17;1-2-3-4-7-15-13-11-8-10(14)5-6-12(11)16-9-17-13/h1-8H,9H2;5-6,8-9H,2-4,7,14H2,1H3,(H,15,16,17) |
| InChIKey | QSMQTQRVXGVHLV-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|