C20H22ClFN4O — CID 69221619
4-N-[3-chloro-4-[(3-fluorophenyl)methoxy]pentyl]quinazoline-4,6-diamine (PubChem CID 69221619) has the molecular formula C20H22ClFN4O and a molecular weight of 388.87 g/mol. Its IUPAC name is 4-N-[3-chloro-4-[(3-fluorophenyl)methoxy]pentyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[3-chloro-4-[(3-fluorophenyl)methoxy]pentyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 69221619 |
| Molecular Formula | C20H22ClFN4O |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-N-[3-chloro-4-[(3-fluorophenyl)methoxy]pentyl]quinazoline-4,6-diamine |
| SMILES | CC(OCc1cccc(F)c1)C(Cl)CCNc1ncnc2ccc(N)cc12 |
| InChI | InChI=1S/C20H22ClFN4O/c1-13(27-11-14-3-2-4-15(22)9-14)18(21)7-8-24-20-17-10-16(23)5-6-19(17)25-12-26-20/h2-6,9-10,12-13,18H,7-8,11,23H2,1H3,(H,24,25,26) |
| InChIKey | WNNNTYNYNMOWSM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|