C11H18N6O4 — CID 174732773
amino-[6-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid (PubChem CID 174732773) has the molecular formula C11H18N6O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is amino-[6-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid.
| Compound Name | amino-[6-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid |
|---|---|
| PubChem CID | 174732773 |
| Molecular Formula | C11H18N6O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | amino-[6-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamic acid |
| SMILES | Cn1ncc([N+](=O)[O-])c1C1CNCCC(N(N)C(=O)O)C1 |
| InChI | InChI=1S/C11H18N6O4/c1-15-10(9(6-14-15)17(20)21)7-4-8(2-3-13-5-7)16(12)11(18)19/h6-8,13H,2-5,12H2,1H3,(H,18,19) |
| InChIKey | WUYVGANYYMJJSI-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 139.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|