About 2-(dimethylamino)ethyl carbonochloridate;methanesulfonic acid
2-(dimethylamino)ethyl carbonochloridate;methanesulfonic acid (PubChem CID 174735571) has the molecular formula C6H14ClNO5S
and a molecular weight of 247.70 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl carbonochloridate;methanesulfonic acid.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl carbonochloridate;methanesulfonic acid |
| PubChem CID | 174735571 |
| Molecular Formula | C6H14ClNO5S |
| Molecular Weight | 247.70 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 2-(dimethylamino)ethyl carbonochloridate;methanesulfonic acid |
| SMILES | CN(C)CCOC(=O)Cl.CS(=O)(=O)O |
| InChI | InChI=1S/C5H10ClNO2.CH4O3S/c1-7(2)3-4-9-5(6)8;1-5(2,3)4/h3-4H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | NYHMPIFMLYYACV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.70 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl carbonochloridate;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl carbonochloridate;methanesulfonic acid?
The IUPAC name of 2-(dimethylamino)ethyl carbonochloridate;methanesulfonic acid (CID 174735571) is 2-(dimethylamino)ethyl carbonochloridate;methanesulfonic acid.
What is the SMILES notation for 2-(dimethylamino)ethyl carbonochloridate;methanesulfonic acid?
The canonical SMILES for 2-(dimethylamino)ethyl carbonochloridate;methanesulfonic acid is CN(C)CCOC(=O)Cl.CS(=O)(=O)O.
What is the InChIKey of 2-(dimethylamino)ethyl carbonochloridate;methanesulfonic acid?
The InChIKey is NYHMPIFMLYYACV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10ClNO2.CH4O3S/c1-7(2)3-4-9-5(6)8;1-5(2,3)4/h3-4H2,1-2H3;1H3,(H,2,3,4).
What are the key properties of 2-(dimethylamino)ethyl carbonochloridate;methanesulfonic acid?
2-(dimethylamino)ethyl carbonochloridate;methanesulfonic acid has a molecular weight of 247.70 g/mol, XLogP of 0.43, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl carbonochloridate;methanesulfonic acid is sourced from PubChem (CID 174735571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).