About (1-tritylpyrazol-4-yl) acetate
(1-tritylpyrazol-4-yl) acetate (PubChem CID 174736849) has the molecular formula C24H20N2O2
and a molecular weight of 368.44 g/mol. Its IUPAC name is (1-tritylpyrazol-4-yl) acetate.
Molecular Properties
| Compound Name | (1-tritylpyrazol-4-yl) acetate |
| PubChem CID | 174736849 |
| Molecular Formula | C24H20N2O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (1-tritylpyrazol-4-yl) acetate |
| SMILES | CC(=O)Oc1cnn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H20N2O2/c1-19(27)28-23-17-25-26(18-23)24(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-18H,1H3 |
| InChIKey | VJAAJGIMHUTBKS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (1-tritylpyrazol-4-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-tritylpyrazol-4-yl) acetate?
The IUPAC name of (1-tritylpyrazol-4-yl) acetate (CID 174736849) is (1-tritylpyrazol-4-yl) acetate.
What is the SMILES notation for (1-tritylpyrazol-4-yl) acetate?
The canonical SMILES for (1-tritylpyrazol-4-yl) acetate is CC(=O)Oc1cnn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c1.
What is the InChIKey of (1-tritylpyrazol-4-yl) acetate?
The InChIKey is VJAAJGIMHUTBKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O2/c1-19(27)28-23-17-25-26(18-23)24(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-18H,1H3.
What are the key properties of (1-tritylpyrazol-4-yl) acetate?
(1-tritylpyrazol-4-yl) acetate has a molecular weight of 368.44 g/mol, XLogP of 4.65, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-tritylpyrazol-4-yl) acetate is sourced from PubChem (CID 174736849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).