C20H24N2O4 — CID 174740783
benzyl N-[1-(5-amino-2-methoxyphenyl)-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 174740783) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is benzyl N-[1-(5-amino-2-methoxyphenyl)-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[1-(5-amino-2-methoxyphenyl)-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 174740783 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | benzyl N-[1-(5-amino-2-methoxyphenyl)-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | COc1ccc(N)cc1C(=O)C(NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C20H24N2O4/c1-13(2)18(19(23)16-11-15(21)9-10-17(16)25-3)22-20(24)26-12-14-7-5-4-6-8-14/h4-11,13,18H,12,21H2,1-3H3,(H,22,24) |
| InChIKey | QXNFQUBMMFNFMB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|