C18H35N3 — CID 174740959
N,N-bis(piperidin-1-ylmethyl)cyclohexanamine (PubChem CID 174740959) has the molecular formula C18H35N3 and a molecular weight of 293.50 g/mol. Its IUPAC name is N,N-bis(piperidin-1-ylmethyl)cyclohexanamine.
| Compound Name | N,N-bis(piperidin-1-ylmethyl)cyclohexanamine |
|---|---|
| PubChem CID | 174740959 |
| Molecular Formula | C18H35N3 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.28 |
| IUPAC Name | N,N-bis(piperidin-1-ylmethyl)cyclohexanamine |
| SMILES | C1CCC(N(CN2CCCCC2)CN2CCCCC2)CC1 |
| InChI | InChI=1S/C18H35N3/c1-4-10-18(11-5-1)21(16-19-12-6-2-7-13-19)17-20-14-8-3-9-15-20/h18H,1-17H2 |
| InChIKey | GJEGAHCVDLETLP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |