C18H14F3N3O2S2 — CID 174743302
N-[4-[1-[3-(trifluoromethyl)phenyl]prop-2-enylsulfonyl]phenyl]-1,3,4-thiadiazol-2-amine (PubChem CID 174743302) has the molecular formula C18H14F3N3O2S2 and a molecular weight of 425.46 g/mol. Its IUPAC name is N-[4-[1-[3-(trifluoromethyl)phenyl]prop-2-enylsulfonyl]phenyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[4-[1-[3-(trifluoromethyl)phenyl]prop-2-enylsulfonyl]phenyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 174743302 |
| Molecular Formula | C18H14F3N3O2S2 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | N-[4-[1-[3-(trifluoromethyl)phenyl]prop-2-enylsulfonyl]phenyl]-1,3,4-thiadiazol-2-amine |
| SMILES | C=CC(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccc(Nc2nncs2)cc1 |
| InChI | InChI=1S/C18H14F3N3O2S2/c1-2-16(12-4-3-5-13(10-12)18(19,20)21)28(25,26)15-8-6-14(7-9-15)23-17-24-22-11-27-17/h2-11,16H,1H2,(H,23,24) |
| InChIKey | TTWYCCSCYAGFPM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|