C14H24N2O5S — CID 174743577
(2R)-3-methyl-2-[[(2S)-2-(6-oxohexanoylamino)-3-sulfanylpropanoyl]amino]butanoic acid (PubChem CID 174743577) has the molecular formula C14H24N2O5S and a molecular weight of 332.42 g/mol. Its IUPAC name is (2R)-3-methyl-2-[[(2S)-2-(6-oxohexanoylamino)-3-sulfanylpropanoyl]amino]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[[(2S)-2-(6-oxohexanoylamino)-3-sulfanylpropanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 174743577 |
| Molecular Formula | C14H24N2O5S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (2R)-3-methyl-2-[[(2S)-2-(6-oxohexanoylamino)-3-sulfanylpropanoyl]amino]butanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)[C@@H](CS)NC(=O)CCCCC=O)C(=O)O |
| InChI | InChI=1S/C14H24N2O5S/c1-9(2)12(14(20)21)16-13(19)10(8-22)15-11(18)6-4-3-5-7-17/h7,9-10,12,22H,3-6,8H2,1-2H3,(H,15,18)(H,16,19)(H,20,21)/t10-,12-/m1/s1 |
| InChIKey | FZSKIHTWJPRANZ-ZYHUDNBSSA-N |
| XLogP | 0.39 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|