C37H32Cl4N4O2Zn — CID 174750270
dichlorozinc;21,22-dihydroporphyrin;ethyl 5,5-dichloro-4-naphthalen-1-ylpentanoate (PubChem CID 174750270) has the molecular formula C37H32Cl4N4O2Zn and a molecular weight of 771.89 g/mol. Its IUPAC name is dichlorozinc;21,22-dihydroporphyrin;ethyl 5,5-dichloro-4-naphthalen-1-ylpentanoate.
| Compound Name | dichlorozinc;21,22-dihydroporphyrin;ethyl 5,5-dichloro-4-naphthalen-1-ylpentanoate |
|---|---|
| PubChem CID | 174750270 |
| Molecular Formula | C37H32Cl4N4O2Zn |
| Molecular Weight | 771.89 g/mol |
| Exact Mass | 768.06 |
| IUPAC Name | dichlorozinc;21,22-dihydroporphyrin;ethyl 5,5-dichloro-4-naphthalen-1-ylpentanoate |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.CCOC(=O)CCC(c1cccc2ccccc12)C(Cl)Cl.Cl[Zn]Cl |
| InChI | InChI=1S/C20H14N4.C17H18Cl2O2.2ClH.Zn/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-2-21-16(20)11-10-15(17(18)19)14-9-5-7-12-6-3-4-8-13(12)14;;;/h1-12,21-22H;3-9,15,17H,2,10-11H2,1H3;2*1H;/q;;;;+2/p-2/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;;;; |
| InChIKey | JVJZLFVRFOPBQS-YCWHZZGXSA-L |
| XLogP | 11.10 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.89 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|