C66H52N8O2 — CID 174843789
bis(21,22-dihydroporphyrin);ethyl 4,4-dinaphthalen-1-ylbutanoate (PubChem CID 174843789) has the molecular formula C66H52N8O2 and a molecular weight of 989.20 g/mol. Its IUPAC name is bis(21,22-dihydroporphyrin);ethyl 4,4-dinaphthalen-1-ylbutanoate.
| Compound Name | bis(21,22-dihydroporphyrin);ethyl 4,4-dinaphthalen-1-ylbutanoate |
|---|---|
| PubChem CID | 174843789 |
| Molecular Formula | C66H52N8O2 |
| Molecular Weight | 989.20 g/mol |
| Exact Mass | 988.42 |
| IUPAC Name | bis(21,22-dihydroporphyrin);ethyl 4,4-dinaphthalen-1-ylbutanoate |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.CCOC(=O)CCC(c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H24O2.2C20H14N4/c1-2-28-26(27)18-17-25(23-15-7-11-19-9-3-5-13-21(19)23)24-16-8-12-20-10-4-6-14-22(20)24;2*1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h3-16,25H,2,17-18H2,1H3;2*1-12,21-22H/b;2*13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12- |
| InChIKey | HGEMTEFRNNBNFJ-OAKMFNGPSA-N |
| XLogP | 15.78 |
| TPSA | 141.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 989.20 |
| LogP ≤ 5 | 15.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |