C38H29CoN5 — CID 175161572
cobalt;21,22-dihydroporphyrin;N,N-diphenylaniline (PubChem CID 175161572) has the molecular formula C38H29CoN5 and a molecular weight of 614.62 g/mol. Its IUPAC name is cobalt;21,22-dihydroporphyrin;N,N-diphenylaniline.
| Compound Name | cobalt;21,22-dihydroporphyrin;N,N-diphenylaniline |
|---|---|
| PubChem CID | 175161572 |
| Molecular Formula | C38H29CoN5 |
| Molecular Weight | 614.62 g/mol |
| Exact Mass | 614.18 |
| IUPAC Name | cobalt;21,22-dihydroporphyrin;N,N-diphenylaniline |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.[Co].c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H14N4.C18H15N.Co/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-12,21-22H;1-15H;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | BVAVRIQKFHKSQM-IAULSPAKSA-N |
| XLogP | 9.81 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.62 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |