C30H22CoN6 — CID 174888038
cobalt;21,22-dihydroporphyrin;2-pyridin-2-ylpyridine (PubChem CID 174888038) has the molecular formula C30H22CoN6 and a molecular weight of 525.48 g/mol. Its IUPAC name is cobalt;21,22-dihydroporphyrin;2-pyridin-2-ylpyridine.
| Compound Name | cobalt;21,22-dihydroporphyrin;2-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 174888038 |
| Molecular Formula | C30H22CoN6 |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | cobalt;21,22-dihydroporphyrin;2-pyridin-2-ylpyridine |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.[Co].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C20H14N4.C10H8N2.Co/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-3-7-11-9(5-1)10-6-2-4-8-12-10;/h1-12,21-22H;1-8H;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | DVGMVGUFLXONHC-IAULSPAKSA-N |
| XLogP | 6.80 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |