About [(6S)-6-(3-bromophenyl)cyclohexa-1,3-dien-1-yl] methanesulfonate
[(6S)-6-(3-bromophenyl)cyclohexa-1,3-dien-1-yl] methanesulfonate (PubChem CID 174755048) has the molecular formula C13H13BrO3S
and a molecular weight of 329.22 g/mol. Its IUPAC name is [(6S)-6-(3-bromophenyl)cyclohexa-1,3-dien-1-yl] methanesulfonate.
Molecular Properties
| Compound Name | [(6S)-6-(3-bromophenyl)cyclohexa-1,3-dien-1-yl] methanesulfonate |
| PubChem CID | 174755048 |
| Molecular Formula | C13H13BrO3S |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | [(6S)-6-(3-bromophenyl)cyclohexa-1,3-dien-1-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1=CC=CC[C@H]1c1cccc(Br)c1 |
| InChI | InChI=1S/C13H13BrO3S/c1-18(15,16)17-13-8-3-2-7-12(13)10-5-4-6-11(14)9-10/h2-6,8-9,12H,7H2,1H3/t12-/m0/s1 |
| InChIKey | QEPYZLORSONEOM-LBPRGKRZSA-N |
| XLogP | 3.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(6S)-6-(3-bromophenyl)cyclohexa-1,3-dien-1-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6S)-6-(3-bromophenyl)cyclohexa-1,3-dien-1-yl] methanesulfonate?
The IUPAC name of [(6S)-6-(3-bromophenyl)cyclohexa-1,3-dien-1-yl] methanesulfonate (CID 174755048) is [(6S)-6-(3-bromophenyl)cyclohexa-1,3-dien-1-yl] methanesulfonate.
What is the SMILES notation for [(6S)-6-(3-bromophenyl)cyclohexa-1,3-dien-1-yl] methanesulfonate?
The canonical SMILES for [(6S)-6-(3-bromophenyl)cyclohexa-1,3-dien-1-yl] methanesulfonate is CS(=O)(=O)OC1=CC=CC[C@H]1c1cccc(Br)c1.
What is the InChIKey of [(6S)-6-(3-bromophenyl)cyclohexa-1,3-dien-1-yl] methanesulfonate?
The InChIKey is QEPYZLORSONEOM-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H13BrO3S/c1-18(15,16)17-13-8-3-2-7-12(13)10-5-4-6-11(14)9-10/h2-6,8-9,12H,7H2,1H3/t12-/m0/s1.
What are the key properties of [(6S)-6-(3-bromophenyl)cyclohexa-1,3-dien-1-yl] methanesulfonate?
[(6S)-6-(3-bromophenyl)cyclohexa-1,3-dien-1-yl] methanesulfonate has a molecular weight of 329.22 g/mol, XLogP of 3.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(6S)-6-(3-bromophenyl)cyclohexa-1,3-dien-1-yl] methanesulfonate is sourced from PubChem (CID 174755048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).