About 2-(2,6-difluorobenzoyl)-6-(trifluoromethyl)pyridine-3-carbohydrazide
2-(2,6-difluorobenzoyl)-6-(trifluoromethyl)pyridine-3-carbohydrazide (PubChem CID 174755437) has the molecular formula C14H8F5N3O2
and a molecular weight of 345.23 g/mol. Its IUPAC name is 2-(2,6-difluorobenzoyl)-6-(trifluoromethyl)pyridine-3-carbohydrazide.
Molecular Properties
| Compound Name | 2-(2,6-difluorobenzoyl)-6-(trifluoromethyl)pyridine-3-carbohydrazide |
| PubChem CID | 174755437 |
| Molecular Formula | C14H8F5N3O2 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 2-(2,6-difluorobenzoyl)-6-(trifluoromethyl)pyridine-3-carbohydrazide |
| SMILES | NNC(=O)c1ccc(C(F)(F)F)nc1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C14H8F5N3O2/c15-7-2-1-3-8(16)10(7)12(23)11-6(13(24)22-20)4-5-9(21-11)14(17,18)19/h1-5H,20H2,(H,22,24) |
| InChIKey | SAYFYRZGKDRIPC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-difluorobenzoyl)-6-(trifluoromethyl)pyridine-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluorobenzoyl)-6-(trifluoromethyl)pyridine-3-carbohydrazide?
The IUPAC name of 2-(2,6-difluorobenzoyl)-6-(trifluoromethyl)pyridine-3-carbohydrazide (CID 174755437) is 2-(2,6-difluorobenzoyl)-6-(trifluoromethyl)pyridine-3-carbohydrazide.
What is the SMILES notation for 2-(2,6-difluorobenzoyl)-6-(trifluoromethyl)pyridine-3-carbohydrazide?
The canonical SMILES for 2-(2,6-difluorobenzoyl)-6-(trifluoromethyl)pyridine-3-carbohydrazide is NNC(=O)c1ccc(C(F)(F)F)nc1C(=O)c1c(F)cccc1F.
What is the InChIKey of 2-(2,6-difluorobenzoyl)-6-(trifluoromethyl)pyridine-3-carbohydrazide?
The InChIKey is SAYFYRZGKDRIPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F5N3O2/c15-7-2-1-3-8(16)10(7)12(23)11-6(13(24)22-20)4-5-9(21-11)14(17,18)19/h1-5H,20H2,(H,22,24).
What are the key properties of 2-(2,6-difluorobenzoyl)-6-(trifluoromethyl)pyridine-3-carbohydrazide?
2-(2,6-difluorobenzoyl)-6-(trifluoromethyl)pyridine-3-carbohydrazide has a molecular weight of 345.23 g/mol, XLogP of 2.21, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluorobenzoyl)-6-(trifluoromethyl)pyridine-3-carbohydrazide is sourced from PubChem (CID 174755437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).