potassium;hydride;thiophen-2-yloxyboronic acid

C4H6BKO3S — CID 174756854

IUPACpotassium;hydride;thiophen-2-yloxyboronic acid
SMILESOB(O)Oc1cccs1.[H-].[K+]
InChIInChI=1S/C4H5BO3S.K.H/c6-5(7)8-4-2-1-3-9-4;;/h1-3,6-7H;;/q;+1;-1
InChIKeyVCZCPDHYKTZYLS-UHFFFAOYSA-N
MW184.07 g/mol
LogP-2.79
Rot. Bonds2

About potassium;hydride;thiophen-2-yloxyboronic acid

potassium;hydride;thiophen-2-yloxyboronic acid (PubChem CID 174756854) has the molecular formula C4H6BKO3S and a molecular weight of 184.07 g/mol. Its IUPAC name is potassium;hydride;thiophen-2-yloxyboronic acid.

Molecular Properties

Compound Namepotassium;hydride;thiophen-2-yloxyboronic acid
PubChem CID174756854
Molecular FormulaC4H6BKO3S
Molecular Weight184.07 g/mol
Exact Mass183.98
IUPAC Namepotassium;hydride;thiophen-2-yloxyboronic acid
SMILESOB(O)Oc1cccs1.[H-].[K+]
InChIInChI=1S/C4H5BO3S.K.H/c6-5(7)8-4-2-1-3-9-4;;/h1-3,6-7H;;/q;+1;-1
InChIKeyVCZCPDHYKTZYLS-UHFFFAOYSA-N
XLogP-2.79
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.07
LogP ≤ 5-2.79
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze potassium;hydride;thiophen-2-yloxyboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium;hydride;thiophen-2-yloxyboronic acid?
The IUPAC name of potassium;hydride;thiophen-2-yloxyboronic acid (CID 174756854) is potassium;hydride;thiophen-2-yloxyboronic acid.
What is the SMILES notation for potassium;hydride;thiophen-2-yloxyboronic acid?
The canonical SMILES for potassium;hydride;thiophen-2-yloxyboronic acid is OB(O)Oc1cccs1.[H-].[K+].
What is the InChIKey of potassium;hydride;thiophen-2-yloxyboronic acid?
The InChIKey is VCZCPDHYKTZYLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5BO3S.K.H/c6-5(7)8-4-2-1-3-9-4;;/h1-3,6-7H;;/q;+1;-1.
What are the key properties of potassium;hydride;thiophen-2-yloxyboronic acid?
potassium;hydride;thiophen-2-yloxyboronic acid has a molecular weight of 184.07 g/mol, XLogP of -2.79, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;thiophen-2-yloxyboronic acid is sourced from PubChem (CID 174756854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).