About CID 91156277
CID 91156277 (PubChem CID 91156277) has the molecular formula C8H6BOS2
and a molecular weight of 193.08 g/mol.
Molecular Properties
| Compound Name | CID 91156277 |
| PubChem CID | 91156277 |
| Molecular Formula | C8H6BOS2 |
| Molecular Weight | 193.08 g/mol |
| Exact Mass | 193.00 |
| IUPAC Name | — |
| SMILES | [B](Oc1cccs1)c1cccs1 |
| InChI | InChI=1S/C8H6BOS2/c1-3-7(11-5-1)9-10-8-4-2-6-12-8/h1-6H |
| InChIKey | MFUYJAASRZILGD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.08 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 91156277 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91156277?
The IUPAC name of CID 91156277 (CID 91156277) is not available.
What is the SMILES notation for CID 91156277?
The canonical SMILES for CID 91156277 is [B](Oc1cccs1)c1cccs1.
What is the InChIKey of CID 91156277?
The InChIKey is MFUYJAASRZILGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BOS2/c1-3-7(11-5-1)9-10-8-4-2-6-12-8/h1-6H.
What are the key properties of CID 91156277?
CID 91156277 has a molecular weight of 193.08 g/mol, XLogP of 2.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91156277 is sourced from PubChem (CID 91156277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).