C12H12O4 — CID 174758353
cyclopropylmethyl 4-formylbenzenecarboperoxoate (PubChem CID 174758353) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is cyclopropylmethyl 4-formylbenzenecarboperoxoate.
| Compound Name | cyclopropylmethyl 4-formylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 174758353 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | cyclopropylmethyl 4-formylbenzenecarboperoxoate |
| SMILES | O=Cc1ccc(C(=O)OOCC2CC2)cc1 |
| InChI | InChI=1S/C12H12O4/c13-7-9-3-5-11(6-4-9)12(14)16-15-8-10-1-2-10/h3-7,10H,1-2,8H2 |
| InChIKey | JJPPYFCALMACCA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|