C9H14F2 — CID 174758607
3-cyclopropyl-1,1-difluorocyclohexane (PubChem CID 174758607) has the molecular formula C9H14F2 and a molecular weight of 160.21 g/mol. Its IUPAC name is 3-cyclopropyl-1,1-difluorocyclohexane.
| Compound Name | 3-cyclopropyl-1,1-difluorocyclohexane |
|---|---|
| PubChem CID | 174758607 |
| Molecular Formula | C9H14F2 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 3-cyclopropyl-1,1-difluorocyclohexane |
| SMILES | FC1(F)CCCC(C2CC2)C1 |
| InChI | InChI=1S/C9H14F2/c10-9(11)5-1-2-8(6-9)7-3-4-7/h7-8H,1-6H2 |
| InChIKey | NCLZZCCFBRTFAV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |