C14H22F2 — CID 178021547
(3aS,6aR)-2-cyclohexyl-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-pentalene (PubChem CID 178021547) has the molecular formula C14H22F2 and a molecular weight of 228.33 g/mol. Its IUPAC name is (3aS,6aR)-2-cyclohexyl-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-pentalene.
| Compound Name | (3aS,6aR)-2-cyclohexyl-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-pentalene |
|---|---|
| PubChem CID | 178021547 |
| Molecular Formula | C14H22F2 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (3aS,6aR)-2-cyclohexyl-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-pentalene |
| SMILES | FC1(F)C[C@H]2CC(C3CCCCC3)C[C@H]2C1 |
| InChI | InChI=1S/C14H22F2/c15-14(16)8-12-6-11(7-13(12)9-14)10-4-2-1-3-5-10/h10-13H,1-9H2/t11?,12-,13+ |
| InChIKey | JWMVLLXTZKEFCM-YHWZYXNKSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |