C14H13O2P — CID 174759796
[2-(3,5-dimethylphenyl)phenyl]-oxido-oxophosphanium (PubChem CID 174759796) has the molecular formula C14H13O2P and a molecular weight of 244.23 g/mol. Its IUPAC name is [2-(3,5-dimethylphenyl)phenyl]-oxido-oxophosphanium.
| Compound Name | [2-(3,5-dimethylphenyl)phenyl]-oxido-oxophosphanium |
|---|---|
| PubChem CID | 174759796 |
| Molecular Formula | C14H13O2P |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | [2-(3,5-dimethylphenyl)phenyl]-oxido-oxophosphanium |
| SMILES | Cc1cc(C)cc(-c2ccccc2[P+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13O2P/c1-10-7-11(2)9-12(8-10)13-5-3-4-6-14(13)17(15)16/h3-9H,1-2H3 |
| InChIKey | AMIZKVPMLPJPGW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|