C20H21ClN4O2S — CID 17476188
1-(3-chlorophenyl)-3-methyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]thieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 17476188) has the molecular formula C20H21ClN4O2S and a molecular weight of 416.93 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-methyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]thieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-3-methyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]thieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 17476188 |
| Molecular Formula | C20H21ClN4O2S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 1-(3-chlorophenyl)-3-methyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]thieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(-c2cccc(Cl)c2)c2sc(C(=O)NCCCN3CCCC3=O)cc12 |
| InChI | InChI=1S/C20H21ClN4O2S/c1-13-16-12-17(19(27)22-8-4-10-24-9-3-7-18(24)26)28-20(16)25(23-13)15-6-2-5-14(21)11-15/h2,5-6,11-12H,3-4,7-10H2,1H3,(H,22,27) |
| InChIKey | WCDAKJKALGPBLE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|