C16H8F2O4 — CID 174763209
2-(1,4-difluoro-5,8-dihydroxyanthracen-9-yl)-2-oxoacetaldehyde (PubChem CID 174763209) has the molecular formula C16H8F2O4 and a molecular weight of 302.23 g/mol. Its IUPAC name is 2-(1,4-difluoro-5,8-dihydroxyanthracen-9-yl)-2-oxoacetaldehyde.
| Compound Name | 2-(1,4-difluoro-5,8-dihydroxyanthracen-9-yl)-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 174763209 |
| Molecular Formula | C16H8F2O4 |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 2-(1,4-difluoro-5,8-dihydroxyanthracen-9-yl)-2-oxoacetaldehyde |
| SMILES | O=CC(=O)c1c2c(O)ccc(O)c2cc2c(F)ccc(F)c12 |
| InChI | InChI=1S/C16H8F2O4/c17-9-1-2-10(18)14-7(9)5-8-11(20)3-4-12(21)15(8)16(14)13(22)6-19/h1-6,20-21H |
| InChIKey | LEEWRGSRWRAYNZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_naphthol_A(2)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|