C17H30O2 — CID 174765010
3,7-dimethyloct-6-en-1-ol;hepta-1,5-dien-4-one (PubChem CID 174765010) has the molecular formula C17H30O2 and a molecular weight of 266.43 g/mol. Its IUPAC name is 3,7-dimethyloct-6-en-1-ol;hepta-1,5-dien-4-one.
| Compound Name | 3,7-dimethyloct-6-en-1-ol;hepta-1,5-dien-4-one |
|---|---|
| PubChem CID | 174765010 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 3,7-dimethyloct-6-en-1-ol;hepta-1,5-dien-4-one |
| SMILES | C=CCC(=O)C=CC.CC(C)=CCCC(C)CCO |
| InChI | InChI=1S/C10H20O.C7H10O/c1-9(2)5-4-6-10(3)7-8-11;1-3-5-7(8)6-4-2/h5,10-11H,4,6-8H2,1-3H3;3-4,6H,1,5H2,2H3 |
| InChIKey | LXDZAYALXTYGEL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|