C26H35NO3 — CID 174765058
tert-butyl 2-[1-(dibenzylamino)cyclohexyl]oxyacetate (PubChem CID 174765058) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is tert-butyl 2-[1-(dibenzylamino)cyclohexyl]oxyacetate.
| Compound Name | tert-butyl 2-[1-(dibenzylamino)cyclohexyl]oxyacetate |
|---|---|
| PubChem CID | 174765058 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | tert-butyl 2-[1-(dibenzylamino)cyclohexyl]oxyacetate |
| SMILES | CC(C)(C)OC(=O)COC1(N(Cc2ccccc2)Cc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C26H35NO3/c1-25(2,3)30-24(28)21-29-26(17-11-6-12-18-26)27(19-22-13-7-4-8-14-22)20-23-15-9-5-10-16-23/h4-5,7-10,13-16H,6,11-12,17-21H2,1-3H3 |
| InChIKey | MDWDLVPITWJXAQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|